Why structure matters
C₂H₄O₂ is not a unique structural description.
Other compounds can share the same atom counts. Acetic acid is identified by its particular connectivity and chemical structure, not by formula alone.
Molecular compound · carboxylic acid
Acetic acid
C₂H₄O₂
Acetic acid is the two-carbon carboxylic acid CH₃COOH. The –COOH group is the chemically decisive part of the molecule: it can donate a proton, leaving an acetate ion whose negative charge is stabilized by delocalization over two oxygen atoms.
Everyday distinction: vinegar is not pure acetic acid. It is an aqueous mixture containing acetic acid along with water and other components.
Essentials
The carboxyl group, –C(=O)–OH, defines the chemistry.
The condensed formula CH₃COOH is more informative than C₂H₄O₂ because it shows the carbonyl and hydroxyl groups attached to the same carbon atom.
Detail
The reference 2D structure fixes the atom connectivity.
Acetic acid contains a methyl group attached to a carboxyl carbon. One oxygen is represented as carbonyl oxygen and the other as hydroxyl oxygen in the neutral molecule.
Acidic proton
The O–H proton is the one transferred in ordinary acid–base chemistry.
Removing it gives acetate, CH₃COO⁻. The C–H hydrogens on the methyl group are not the protons meant when acetic acid is described as a weak acid in water.
Understand
Deprotonation gives acetate, and resonance helps stabilize it.
Acetic acid transfers a proton to water only partially, so the aqueous system contains an equilibrium mixture. The acetate ion has delocalized electron density over its two oxygen atoms, which stabilizes the conjugate base.
Conjugate pair
CH₃COOH / CH₃COO⁻ differ by one proton.
Recognizing conjugate acid–base pairs makes the equilibrium easier to read: acetic acid loses H⁺ while water gains it to become hydronium.
Reference identifiers
Names and identifiers that pin down the chemical identity.
| Formula | C₂H₄O₂ / CH₃COOH |
|---|---|
| CAS Registry Number | 64-19-7 |
| PubChem CID | 176 |
| Standard InChI | InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
| Canonical SMILES | CC(=O)O |
Advanced
Push past the first model without losing the simple picture.
Why does acetate have two similar C–O bonds?
A single Lewis structure localizes one C=O and one C–O⁻ bond, but resonance delocalizes electron density. The real ion is not rapidly switching between drawings; the resonance hybrid is the physical description.
Is glacial acetic acid the same as vinegar?
No. Glacial acetic acid is a highly concentrated form of the compound, whereas vinegar is a dilute aqueous food mixture.
Does “weak acid” mean safe?
No. Acid strength describes equilibrium ionization, not hazard. Concentrated acetic acid can be corrosive.
Constituent elements